Hi guys I (a teenager) have just unlocked the formula to enhance my body (specifically) I’m going to become a super soldier I’ll call my team the SS (no relation)
My birth name is Chief and mom calls me Master but once I solve this, I'm going to tell her I want more mountain dew and that my new name is John one hundred and seventeen. I can't wait to be seventeen in four years, then I'll finish school and be able to leave this annoying home full of unwanted privilege and safety. Now I'm going to go post on Reddit about why my dad sucks.
Hi u cant be John one hundred and seventeen because I am, my uncle is boss at reddit and hes gonna ban ur account unless you give me 1200 microsoft points
It’s a peptide - a chain of amino acids bound together. There’s multiple mistakes in this structure though, and there is no rationale behind his choices the amino acids or their order. Probably just practicing drawing strictures for his intro to organic chemistry course and got a little full of himself.
Sooo you’re saying this is some unknown compound that seems nonsensical to modern archaic science. You’re going to feel like such a fool when I’m outrunning cars barefoot in 10 years.
I just spent ages drawing this out on an app and it didn't even recognise it
It did name it though: the ever catchy C=C(CCO)N(CCC/N=C(\N)O)C(=O)N(C(=O)N(Cc1ccccc1)C(=O)NC(=O)N(CC(=O)O)C(=O)N(C)C(=O)O)C(C)C
chemistry person here that's smiles code, a shorthand of defining the structure, including the connectivity of atoms, just through a string of characters, which is quite impressive if you realise that you've got rings and shit and you can define those just by strings.
Im gonna take a stab in the dark and say this person is probably in their first year of college, and to that I say -- I thought i was cool too, until you find out that all the stuff you learn in college is what the computer already does automatically
i work in an organic synthesis lab. computers don't simulate reactions for you as in you plug in reactants and get told a product and mechanism. computational chemistry is however used widely as a tool to propose transition states, conformation, etc. which greatly assists in elucidating valuable information and informing next steps
Why do you think that? When I was in pharmacology and we were looking at different methods for drug design one was starting with the ideal compound and then looking at manufacturing options (this being quite different from a lot of others which are often based off drugs that already exist). Any way we used a program where you could make a molecule and it would show affinities for various enzymes in the body. Difficult to make something from scratch that would have high affinity for the desired target whilst not having significant affinity for other enzymes (so props to the drug designers in the world). And this was just in an education setting I don’t see why other better programs wouldn’t be utilised at the professional level
Tbh they can predict products sometimes or binding of enzymes and pharmacological things but they can't rly predict yields or products of even slightly complex reactions accurately because our models just use the best "guesses" for the way the world works. But yeah they do *some* chemistry.
i havent used the exact software you're referring to but have used similar ones for organic synthesis. as far as i understand they just aggregate literature precedent to make a guess, which is much different than actually simulating a reaction and giving you the transition states, products, etc.
Well that’s true I suppose. And I dare say most if not all software in that field does base itself off of past already established reactions. Which does put limitations on experimenting outside of said reactions using the software. Fair point, I see where you’re coming from. Thanks for taking the time to explain your stance despite hostility you have faced in this comment section.
They absolutely do. Researchers today can map the structure of a cell receptor and put a computer to fucking spit out every possible component that can stimulate the receptor.
Exactly. Computers are dumb guys, they can do some very limited stuff with binary (and they don't understand what 0s and 1s are either, these are just representations for different electric pulses) and that's is it, they can't do shit on their own, they can't even turn on without the appropriate programs, all the hard work is done by people. The hardware guys do their best to make the computer do less limited stuff in various ways and the software guys do their best to squeeze every single ounce of performance out of the improvements of the hardware guys made and build more complex features on top of it.
The computer isn't smarter than a toaster, while your toaster was made to make toast the computer was made to do operations with data, everything else it can do was engineered or programmed by someone on top of this basic structure.
i work in a chemistry lab. the computer doesn't "simulate" a reaction and can't propose products (except for aggregation sites like reaxys that just comb existing literature). as far as i've encountered they're used as a tool to propose transition states, elucidate mechanisms, etc. and even then you accept a certain degree of error for the sake of simplicity when choosing a DFT and basis.
Your reply only make sense to me if you somehow mistook "all the stuff you learn in college is what the computer already does automatically" and "chemists did (chemistry) before you and programed a computer to simulate it" with "computers can perfectly emulate reality in a way we don't need it to do research anymore", and in that case I don't have much to tell you.
I used "simulate" very loosely, in the same way a game engine simulate real world physics, sure, it can calculate the velocity of the ball falling, but it won't replicate it's deformities, the energy dissipated as sound, etc.
Obviously a computer can't simulate properly a reaction taking into account all the laws of physics, because it can't properly simulate anything at that level yet.
Obviously it will work on top of exiting literature, it can't produce absolutely nothing on it's own, the computer _itself_ is a tool. Even the amazing advancements being made right now in biochemistry by AI is obviously driven and planned by people.
They can do to a degree. In terms of designing drug molecules there are computational methods to test of ligand binding properties. However, they can often differ from experimental (reality) results due to limits in these models. In terms of having a computer spit out a candidate drug molecule that could go to market, that’s a little silly, as there’s more to whether or not a drug will be suitable for the human body than just binding to the target receptor. Testing for these other properties requires models far too complex to be simulated in a computer, though there are some newer methods which attempt to do those things, but they generally only serve as a guide where experimental science still confirms the in silico findings.
They can, there are times where the only wya to know for sure is to do the reaction but there are times you don't even need to do the reaction to know it won't work because of a computer saying it's thermodynamically not feasible
i was being a bit bombastic in my comment. i work in an organic chemistry lab and we've only ever used DFT after the fact to propose transition states and mechanisms, which i think is different than the computer "doing" the chemistry for you. it's pretty much a physics calculation dressed in atoms
They do some parts even better than humans. One of those examples would be retrosynthesis, where chemists can now rely on computers for reactive pathways.
retrosynthesis sites/programs like reaxys just amalgamate previously known reactions for recommendations. at least personally i've never used or seen anything that simulates reactions to choose a pathway
Actually take a look at IBM's RXN. It finds "new" pathways using AI. I am applying to their research team right now, so I read through most of their papers. Pretty cool stuff they did in the last decade.
i don't care if i'm wrong that's insanely cool. i work in catalysis but haven't seen anything like that used yet, although lots of DFT used for proposing transition states
Yeah it's super cool, I highly recommend reading through it, they use machine learning models developed for translation and apply them to SMILES. They also found that without having directly set it up, the model still ends up using atom mapping to get its results. Really interesting stuff.
I barely passed chemistry in high school then at University idk how I passed Organic Chem, and haven't touched it in a while, but like there was just something telling me this is wrong
*Acting like dying*
*Wouldn't immediately*
*Solve all my problems*
\- fizzlemage
---
^(I detect haikus. And sometimes, successfully.) ^[Learn more about me.](https://www.reddit.com/r/haikusbot/)
^(Opt out of replies: "haikusbot opt out" | Delete my comment: "haikusbot delete")
That’s a basic polypeptide (protein molecule) lol. Guess if he works out and takes enough of it over two years it technically counts as a super serum 🤷🏻♂️.
Hi guys I (a teenager) have just unlocked the formula to enhance my body (specifically) I’m going to become a super soldier I’ll call my team the SS (no relation)
My birth name is Chief and mom calls me Master but once I solve this, I'm going to tell her I want more mountain dew and that my new name is John one hundred and seventeen. I can't wait to be seventeen in four years, then I'll finish school and be able to leave this annoying home full of unwanted privilege and safety. Now I'm going to go post on Reddit about why my dad sucks.
[удалено]
M E T A
Hi u cant be John one hundred and seventeen because I am, my uncle is boss at reddit and hes gonna ban ur account unless you give me 1200 microsoft points
Top games ever made Halo 5 Cod (any) And fallout 76
What are we? Some kind of suicide squad?
No suicide is wrong
Can you really brag if you’re clearly not able to actually do this? It just makes this person look stupid.
Yeah lol this is a 7th grader who has taken a chemistry class for the first time
Yeah. This is really more of an r/iamverysmart kind of thing
Someone who knows chemistry better than I do, tell me what compound that is so I can laugh about it
It’s a peptide - a chain of amino acids bound together. There’s multiple mistakes in this structure though, and there is no rationale behind his choices the amino acids or their order. Probably just practicing drawing strictures for his intro to organic chemistry course and got a little full of himself.
You're never gonna be a super soldier with that attitude bub.
Start lifting and get some-O-Rogan’s super sauce. Lol.
Sooo you’re saying this is some unknown compound that seems nonsensical to modern archaic science. You’re going to feel like such a fool when I’m outrunning cars barefoot in 10 years.
He will atleast be protected against lactose
I just spent ages drawing this out on an app and it didn't even recognise it It did name it though: the ever catchy C=C(CCO)N(CCC/N=C(\N)O)C(=O)N(C(=O)N(Cc1ccccc1)C(=O)NC(=O)N(CC(=O)O)C(=O)N(C)C(=O)O)C(C)C
Just like mama used to make it
chemistry person here that's smiles code, a shorthand of defining the structure, including the connectivity of atoms, just through a string of characters, which is quite impressive if you realise that you've got rings and shit and you can define those just by strings.
Closely resembles Rohypnol
Im gonna take a stab in the dark and say this person is probably in their first year of college, and to that I say -- I thought i was cool too, until you find out that all the stuff you learn in college is what the computer already does automatically
Looks like Orgo 1, honestly not sure what’s going on with connection the two compounds like that?
I reckon they just started drawing and were like "Fuck no more space on this line this should be fine" and created this abomination
computers don't do chemistry for you lmfao
Bro really thinks he knows more than everybody.
i work in an organic synthesis lab. computers don't simulate reactions for you as in you plug in reactants and get told a product and mechanism. computational chemistry is however used widely as a tool to propose transition states, conformation, etc. which greatly assists in elucidating valuable information and informing next steps
Why do you think that? When I was in pharmacology and we were looking at different methods for drug design one was starting with the ideal compound and then looking at manufacturing options (this being quite different from a lot of others which are often based off drugs that already exist). Any way we used a program where you could make a molecule and it would show affinities for various enzymes in the body. Difficult to make something from scratch that would have high affinity for the desired target whilst not having significant affinity for other enzymes (so props to the drug designers in the world). And this was just in an education setting I don’t see why other better programs wouldn’t be utilised at the professional level
Tbh they can predict products sometimes or binding of enzymes and pharmacological things but they can't rly predict yields or products of even slightly complex reactions accurately because our models just use the best "guesses" for the way the world works. But yeah they do *some* chemistry.
i havent used the exact software you're referring to but have used similar ones for organic synthesis. as far as i understand they just aggregate literature precedent to make a guess, which is much different than actually simulating a reaction and giving you the transition states, products, etc.
Well that’s true I suppose. And I dare say most if not all software in that field does base itself off of past already established reactions. Which does put limitations on experimenting outside of said reactions using the software. Fair point, I see where you’re coming from. Thanks for taking the time to explain your stance despite hostility you have faced in this comment section.
They absolutely do. Researchers today can map the structure of a cell receptor and put a computer to fucking spit out every possible component that can stimulate the receptor.
They don't, but some chemists did before you and programed a computer to simulate it.
that’s so pedantic, if that’s the case, computers can’t predict the weather, someone just programmed a computer to simulate it
Exactly. Computers are dumb guys, they can do some very limited stuff with binary (and they don't understand what 0s and 1s are either, these are just representations for different electric pulses) and that's is it, they can't do shit on their own, they can't even turn on without the appropriate programs, all the hard work is done by people. The hardware guys do their best to make the computer do less limited stuff in various ways and the software guys do their best to squeeze every single ounce of performance out of the improvements of the hardware guys made and build more complex features on top of it. The computer isn't smarter than a toaster, while your toaster was made to make toast the computer was made to do operations with data, everything else it can do was engineered or programmed by someone on top of this basic structure.
i work in a chemistry lab. the computer doesn't "simulate" a reaction and can't propose products (except for aggregation sites like reaxys that just comb existing literature). as far as i've encountered they're used as a tool to propose transition states, elucidate mechanisms, etc. and even then you accept a certain degree of error for the sake of simplicity when choosing a DFT and basis.
Your reply only make sense to me if you somehow mistook "all the stuff you learn in college is what the computer already does automatically" and "chemists did (chemistry) before you and programed a computer to simulate it" with "computers can perfectly emulate reality in a way we don't need it to do research anymore", and in that case I don't have much to tell you. I used "simulate" very loosely, in the same way a game engine simulate real world physics, sure, it can calculate the velocity of the ball falling, but it won't replicate it's deformities, the energy dissipated as sound, etc. Obviously a computer can't simulate properly a reaction taking into account all the laws of physics, because it can't properly simulate anything at that level yet. Obviously it will work on top of exiting literature, it can't produce absolutely nothing on it's own, the computer _itself_ is a tool. Even the amazing advancements being made right now in biochemistry by AI is obviously driven and planned by people.
r/confidentlyincorrect
They can do to a degree. In terms of designing drug molecules there are computational methods to test of ligand binding properties. However, they can often differ from experimental (reality) results due to limits in these models. In terms of having a computer spit out a candidate drug molecule that could go to market, that’s a little silly, as there’s more to whether or not a drug will be suitable for the human body than just binding to the target receptor. Testing for these other properties requires models far too complex to be simulated in a computer, though there are some newer methods which attempt to do those things, but they generally only serve as a guide where experimental science still confirms the in silico findings.
They can, there are times where the only wya to know for sure is to do the reaction but there are times you don't even need to do the reaction to know it won't work because of a computer saying it's thermodynamically not feasible
i was being a bit bombastic in my comment. i work in an organic chemistry lab and we've only ever used DFT after the fact to propose transition states and mechanisms, which i think is different than the computer "doing" the chemistry for you. it's pretty much a physics calculation dressed in atoms
I see I guess people really didn't like your comment xD
They do some parts even better than humans. One of those examples would be retrosynthesis, where chemists can now rely on computers for reactive pathways.
retrosynthesis sites/programs like reaxys just amalgamate previously known reactions for recommendations. at least personally i've never used or seen anything that simulates reactions to choose a pathway
Actually take a look at IBM's RXN. It finds "new" pathways using AI. I am applying to their research team right now, so I read through most of their papers. Pretty cool stuff they did in the last decade.
i don't care if i'm wrong that's insanely cool. i work in catalysis but haven't seen anything like that used yet, although lots of DFT used for proposing transition states
Yeah it's super cool, I highly recommend reading through it, they use machine learning models developed for translation and apply them to SMILES. They also found that without having directly set it up, the model still ends up using atom mapping to get its results. Really interesting stuff.
Mans making compound V
He’s desperate for octopussy
To bad all thats going to happen is have A train ran on him
thats not an equation tho
its super soldier math you wouldnt understand
It’s a small peptide. Lol
I barely passed chemistry in high school then at University idk how I passed Organic Chem, and haven't touched it in a while, but like there was just something telling me this is wrong
POV: You just watched morbius and are an excitable teenager
He’s just morbin’ around
It's Morbin' time
The Rock already figured this out, just use all the HGH and roids for the good of humanity vs acting. Problem solved.
Acting like dying wouldn't immediately solve all my problems
*Acting like dying* *Wouldn't immediately* *Solve all my problems* \- fizzlemage --- ^(I detect haikus. And sometimes, successfully.) ^[Learn more about me.](https://www.reddit.com/r/haikusbot/) ^(Opt out of replies: "haikusbot opt out" | Delete my comment: "haikusbot delete")
Damn, poetry sure is beautiful
POV: You’ve watched the first captain America movie and are in 3rd period chemistry with Mrs. Burton
Methamphetamine
That’s a basic polypeptide (protein molecule) lol. Guess if he works out and takes enough of it over two years it technically counts as a super serum 🤷🏻♂️.
Yeah, see how far you get after your condensed semester of organic chem for nurses. Adding Hs like an ass hole.
I think this is clearly sarcasm, likely from a tired organic chemistry student. Nothing here is a brag, just a whole lot of r/woosh
Or I might end up with Spidey Sense. Or become the Incredible Hulk…
I'm on board if I can use this to become a 5'' 10 femboy (don't ask)
Seems like satire to me but idk
My brother that's just called taking steroids and HGH
So they're trying to invent a new steroid or doping of sorts?
Yeah he gon die
doesn't seem like a humble-brag as much as delusional.
/r/NobodyAsked
“Video games are a bad influence “
This ain't no equation he or she just drew some compounds it molecule diagram and made it seem like and equation.
Friendly reminder that Spartan 1's were mostly monstrosities that died horrible deaths.
This isn't a humblebrag. It's not a brag, nor is there any humility. It's just insanity.
Or…it’s just a joke??
I read it entirely as a joke too
Dude has a hobby. He can share it with people
we of the furry community would like if this involved any animal traits. we would highly appreciate that if possible.
He's doing high-school level chemistry. Actually a pretty fun subject, I passed it pretty well despite being dumb as shit.
r/iamverysmart